C19H16Cl2N2O3 — CID 18871928
2,4-dichloro-N'-[2-(4,6-dimethyl-1-benzofuran-3-yl)acetyl]benzohydrazide (PubChem CID 18871928) has the molecular formula C19H16Cl2N2O3 and a molecular weight of 391.25 g/mol. Its IUPAC name is 2,4-dichloro-N'-[2-(4,6-dimethyl-1-benzofuran-3-yl)acetyl]benzohydrazide.
| Compound Name | 2,4-dichloro-N'-[2-(4,6-dimethyl-1-benzofuran-3-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 18871928 |
| Molecular Formula | C19H16Cl2N2O3 |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | 2,4-dichloro-N'-[2-(4,6-dimethyl-1-benzofuran-3-yl)acetyl]benzohydrazide |
| SMILES | Cc1cc(C)c2c(CC(=O)NNC(=O)c3ccc(Cl)cc3Cl)coc2c1 |
| InChI | InChI=1S/C19H16Cl2N2O3/c1-10-5-11(2)18-12(9-26-16(18)6-10)7-17(24)22-23-19(25)14-4-3-13(20)8-15(14)21/h3-6,8-9H,7H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | UPPRWKFHVGZGTJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|