C22H32N2O4SZn — CID 174963081
2-[(4-hydroxy-3-methoxyphenyl)methyl]nonanamide;1-hydroxypyridine-2-thione;zinc (PubChem CID 174963081) has the molecular formula C22H32N2O4SZn and a molecular weight of 485.97 g/mol. Its IUPAC name is 2-[(4-hydroxy-3-methoxyphenyl)methyl]nonanamide;1-hydroxypyridine-2-thione;zinc.
| Compound Name | 2-[(4-hydroxy-3-methoxyphenyl)methyl]nonanamide;1-hydroxypyridine-2-thione;zinc |
|---|---|
| PubChem CID | 174963081 |
| Molecular Formula | C22H32N2O4SZn |
| Molecular Weight | 485.97 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 2-[(4-hydroxy-3-methoxyphenyl)methyl]nonanamide;1-hydroxypyridine-2-thione;zinc |
| SMILES | CCCCCCCC(Cc1ccc(O)c(OC)c1)C(N)=O.On1ccccc1=S.[Zn] |
| InChI | InChI=1S/C17H27NO3.C5H5NOS.Zn/c1-3-4-5-6-7-8-14(17(18)20)11-13-9-10-15(19)16(12-13)21-2;7-6-4-2-1-3-5(6)8;/h9-10,12,14,19H,3-8,11H2,1-2H3,(H2,18,20);1-4,7H; |
| InChIKey | VXNHIXLVTOCLQO-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.97 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|