C16H13N3O3S — CID 174969217
6-(4-cyano-3-methoxyphenyl)-1H-indole-3-sulfonamide (PubChem CID 174969217) has the molecular formula C16H13N3O3S and a molecular weight of 327.37 g/mol. Its IUPAC name is 6-(4-cyano-3-methoxyphenyl)-1H-indole-3-sulfonamide.
| Compound Name | 6-(4-cyano-3-methoxyphenyl)-1H-indole-3-sulfonamide |
|---|---|
| PubChem CID | 174969217 |
| Molecular Formula | C16H13N3O3S |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 6-(4-cyano-3-methoxyphenyl)-1H-indole-3-sulfonamide |
| SMILES | COc1cc(-c2ccc3c(S(N)(=O)=O)c[nH]c3c2)ccc1C#N |
| InChI | InChI=1S/C16H13N3O3S/c1-22-15-7-11(2-3-12(15)8-17)10-4-5-13-14(6-10)19-9-16(13)23(18,20)21/h2-7,9,19H,1H3,(H2,18,20,21) |
| InChIKey | CEIAGBMZYZZIBR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 108.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |