C16H29NaO4 — CID 174969293
sodium 3-oxo-3-(2,2,3-trimethyldecan-3-yloxy)propanoate (PubChem CID 174969293) has the molecular formula C16H29NaO4 and a molecular weight of 308.39 g/mol. Its IUPAC name is sodium 3-oxo-3-(2,2,3-trimethyldecan-3-yloxy)propanoate.
| Compound Name | sodium 3-oxo-3-(2,2,3-trimethyldecan-3-yloxy)propanoate |
|---|---|
| PubChem CID | 174969293 |
| Molecular Formula | C16H29NaO4 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | sodium 3-oxo-3-(2,2,3-trimethyldecan-3-yloxy)propanoate |
| SMILES | CCCCCCCC(C)(OC(=O)CC(=O)[O-])C(C)(C)C.[Na+] |
| InChI | InChI=1S/C16H30O4.Na/c1-6-7-8-9-10-11-16(5,15(2,3)4)20-14(19)12-13(17)18;/h6-12H2,1-5H3,(H,17,18);/q;+1/p-1 |
| InChIKey | AXRFJGAZIRRJIA-UHFFFAOYSA-M |
| XLogP | -0.16 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|