C14H25KO4 — CID 175226268
potassium 3-oxo-3-(2,2,3-trimethyloctan-3-yloxy)propanoate (PubChem CID 175226268) has the molecular formula C14H25KO4 and a molecular weight of 296.45 g/mol. Its IUPAC name is potassium 3-oxo-3-(2,2,3-trimethyloctan-3-yloxy)propanoate.
| Compound Name | potassium 3-oxo-3-(2,2,3-trimethyloctan-3-yloxy)propanoate |
|---|---|
| PubChem CID | 175226268 |
| Molecular Formula | C14H25KO4 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | potassium 3-oxo-3-(2,2,3-trimethyloctan-3-yloxy)propanoate |
| SMILES | CCCCCC(C)(OC(=O)CC(=O)[O-])C(C)(C)C.[K+] |
| InChI | InChI=1S/C14H26O4.K/c1-6-7-8-9-14(5,13(2,3)4)18-12(17)10-11(15)16;/h6-10H2,1-5H3,(H,15,16);/q;+1/p-1 |
| InChIKey | UIHXKHPCTVYYAS-UHFFFAOYSA-M |
| XLogP | -0.94 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|