C17H31KO4 — CID 175224927
potassium 3-oxo-3-(2,2,3-trimethylundecan-3-yloxy)propanoate (PubChem CID 175224927) has the molecular formula C17H31KO4 and a molecular weight of 338.53 g/mol. Its IUPAC name is potassium 3-oxo-3-(2,2,3-trimethylundecan-3-yloxy)propanoate.
| Compound Name | potassium 3-oxo-3-(2,2,3-trimethylundecan-3-yloxy)propanoate |
|---|---|
| PubChem CID | 175224927 |
| Molecular Formula | C17H31KO4 |
| Molecular Weight | 338.53 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | potassium 3-oxo-3-(2,2,3-trimethylundecan-3-yloxy)propanoate |
| SMILES | CCCCCCCCC(C)(OC(=O)CC(=O)[O-])C(C)(C)C.[K+] |
| InChI | InChI=1S/C17H32O4.K/c1-6-7-8-9-10-11-12-17(5,16(2,3)4)21-15(20)13-14(18)19;/h6-13H2,1-5H3,(H,18,19);/q;+1/p-1 |
| InChIKey | SVLMXPYUODLDLS-UHFFFAOYSA-M |
| XLogP | 0.23 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.53 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|