C14H26O4 — CID 175226013
3-oxo-3-(2,2,3-trimethyloctan-3-yloxy)propanoic acid (PubChem CID 175226013) has the molecular formula C14H26O4 and a molecular weight of 258.36 g/mol. Its IUPAC name is 3-oxo-3-(2,2,3-trimethyloctan-3-yloxy)propanoic acid.
| Compound Name | 3-oxo-3-(2,2,3-trimethyloctan-3-yloxy)propanoic acid |
|---|---|
| PubChem CID | 175226013 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 3-oxo-3-(2,2,3-trimethyloctan-3-yloxy)propanoic acid |
| SMILES | CCCCCC(C)(OC(=O)CC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C14H26O4/c1-6-7-8-9-14(5,13(2,3)4)18-12(17)10-11(15)16/h6-10H2,1-5H3,(H,15,16) |
| InChIKey | IFVPKZJFLBAGSS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|