C16H25IN2O5 — CID 174970058
tert-butyl formate;N-[(4-hydroxypiperidin-4-yl)methyl]-N-(2-iodofuran-3-yl)formamide (PubChem CID 174970058) has the molecular formula C16H25IN2O5 and a molecular weight of 452.29 g/mol. Its IUPAC name is tert-butyl formate;N-[(4-hydroxypiperidin-4-yl)methyl]-N-(2-iodofuran-3-yl)formamide.
| Compound Name | tert-butyl formate;N-[(4-hydroxypiperidin-4-yl)methyl]-N-(2-iodofuran-3-yl)formamide |
|---|---|
| PubChem CID | 174970058 |
| Molecular Formula | C16H25IN2O5 |
| Molecular Weight | 452.29 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | tert-butyl formate;N-[(4-hydroxypiperidin-4-yl)methyl]-N-(2-iodofuran-3-yl)formamide |
| SMILES | CC(C)(C)OC=O.O=CN(CC1(O)CCNCC1)c1ccoc1I |
| InChI | InChI=1S/C11H15IN2O3.C5H10O2/c12-10-9(1-6-17-10)14(8-15)7-11(16)2-4-13-5-3-11;1-5(2,3)7-4-6/h1,6,8,13,16H,2-5,7H2;4H,1-3H3 |
| InChIKey | RONPNHPNFCEFLK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|