C18H32O10 — CID 174974805
butane-1,1-diol;1,6-dioxecane-2,5-dione;hexanedioic acid (PubChem CID 174974805) has the molecular formula C18H32O10 and a molecular weight of 408.44 g/mol. Its IUPAC name is butane-1,1-diol;1,6-dioxecane-2,5-dione;hexanedioic acid.
| Compound Name | butane-1,1-diol;1,6-dioxecane-2,5-dione;hexanedioic acid |
|---|---|
| PubChem CID | 174974805 |
| Molecular Formula | C18H32O10 |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | butane-1,1-diol;1,6-dioxecane-2,5-dione;hexanedioic acid |
| SMILES | CCCC(O)O.O=C(O)CCCCC(=O)O.O=C1CCC(=O)OCCCCO1 |
| InChI | InChI=1S/C8H12O4.C6H10O4.C4H10O2/c9-7-3-4-8(10)12-6-2-1-5-11-7;7-5(8)3-1-2-4-6(9)10;1-2-3-4(5)6/h1-6H2;1-4H2,(H,7,8)(H,9,10);4-6H,2-3H2,1H3 |
| InChIKey | NEEGCRIHDCYOCT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|