C9H13FN2O2 — CID 174975655
[1-fluoro-2-(3-propan-2-yl-1H-pyrazol-5-yl)ethyl] formate (PubChem CID 174975655) has the molecular formula C9H13FN2O2 and a molecular weight of 200.21 g/mol. Its IUPAC name is [1-fluoro-2-(3-propan-2-yl-1H-pyrazol-5-yl)ethyl] formate.
| Compound Name | [1-fluoro-2-(3-propan-2-yl-1H-pyrazol-5-yl)ethyl] formate |
|---|---|
| PubChem CID | 174975655 |
| Molecular Formula | C9H13FN2O2 |
| Molecular Weight | 200.21 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | [1-fluoro-2-(3-propan-2-yl-1H-pyrazol-5-yl)ethyl] formate |
| SMILES | CC(C)c1cc(CC(F)OC=O)[nH]n1 |
| InChI | InChI=1S/C9H13FN2O2/c1-6(2)8-3-7(11-12-8)4-9(10)14-5-13/h3,5-6,9H,4H2,1-2H3,(H,11,12) |
| InChIKey | NZZULDYDUQIPQH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.21 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|