C13H24O — CID 174976448
[(E)-3,7-dimethyloct-1-enoxy]cyclopropane (PubChem CID 174976448) has the molecular formula C13H24O and a molecular weight of 196.33 g/mol. Its IUPAC name is [(E)-3,7-dimethyloct-1-enoxy]cyclopropane.
| Compound Name | [(E)-3,7-dimethyloct-1-enoxy]cyclopropane |
|---|---|
| PubChem CID | 174976448 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | [(E)-3,7-dimethyloct-1-enoxy]cyclopropane |
| SMILES | CC(C)CCCC(C)/C=C/OC1CC1 |
| InChI | InChI=1S/C13H24O/c1-11(2)5-4-6-12(3)9-10-14-13-7-8-13/h9-13H,4-8H2,1-3H3/b10-9+ |
| InChIKey | XZGUFUVGQDTGGT-MDZDMXLPSA-N |
| XLogP | 4.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|