C10H20O8 — CID 174981520
3-ethoxy-2,3,4,5-tetrahydroxy-2,4-dimethoxyhexanal (PubChem CID 174981520) has the molecular formula C10H20O8 and a molecular weight of 268.26 g/mol. Its IUPAC name is 3-ethoxy-2,3,4,5-tetrahydroxy-2,4-dimethoxyhexanal.
| Compound Name | 3-ethoxy-2,3,4,5-tetrahydroxy-2,4-dimethoxyhexanal |
|---|---|
| PubChem CID | 174981520 |
| Molecular Formula | C10H20O8 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 3-ethoxy-2,3,4,5-tetrahydroxy-2,4-dimethoxyhexanal |
| SMILES | CCOC(O)(C(O)(C=O)OC)C(O)(OC)C(C)O |
| InChI | InChI=1S/C10H20O8/c1-5-18-10(15,8(13,6-11)16-3)9(14,17-4)7(2)12/h6-7,12-15H,5H2,1-4H3 |
| InChIKey | ZUSXURJSTLZLNY-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|