C10H20NO5+ — CID 174981768
2,2-diacetyloxyethyl-(2-hydroxyethyl)-dimethylazanium (PubChem CID 174981768) has the molecular formula C10H20NO5+ and a molecular weight of 234.27 g/mol. Its IUPAC name is 2,2-diacetyloxyethyl-(2-hydroxyethyl)-dimethylazanium.
| Compound Name | 2,2-diacetyloxyethyl-(2-hydroxyethyl)-dimethylazanium |
|---|---|
| PubChem CID | 174981768 |
| Molecular Formula | C10H20NO5+ |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 2,2-diacetyloxyethyl-(2-hydroxyethyl)-dimethylazanium |
| SMILES | CC(=O)OC(C[N+](C)(C)CCO)OC(C)=O |
| InChI | InChI=1S/C10H20NO5/c1-8(13)15-10(16-9(2)14)7-11(3,4)5-6-12/h10,12H,5-7H2,1-4H3/q+1 |
| InChIKey | LVIWTDUYQBFPBI-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|