About diacetoxyethylsilane
diacetoxyethylsilane (PubChem CID 57248642) has the molecular formula C6H9O4Si
and a molecular weight of 173.22 g/mol.
Molecular Properties
| Compound Name | diacetoxyethylsilane |
| PubChem CID | 57248642 |
| Molecular Formula | C6H9O4Si |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.03 |
| IUPAC Name | — |
| SMILES | CC(=O)OC(C[Si])OC(C)=O |
| InChI | InChI=1S/C6H9O4Si/c1-4(7)9-6(3-11)10-5(2)8/h6H,3H2,1-2H3 |
| InChIKey | SPOAZMIWXSASQN-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze diacetoxyethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diacetoxyethylsilane?
The IUPAC name of diacetoxyethylsilane (CID 57248642) is not available.
What is the SMILES notation for diacetoxyethylsilane?
The canonical SMILES for diacetoxyethylsilane is CC(=O)OC(C[Si])OC(C)=O.
What is the InChIKey of diacetoxyethylsilane?
The InChIKey is SPOAZMIWXSASQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9O4Si/c1-4(7)9-6(3-11)10-5(2)8/h6H,3H2,1-2H3.
What are the key properties of diacetoxyethylsilane?
diacetoxyethylsilane has a molecular weight of 173.22 g/mol, XLogP of 0.03, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diacetoxyethylsilane is sourced from PubChem (CID 57248642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).