About 3-cyanopropyl-(2-hydroxyethyl)-dimethylazanium;acetate;hydrobromide
3-cyanopropyl-(2-hydroxyethyl)-dimethylazanium;acetate;hydrobromide (PubChem CID 23623162) has the molecular formula C10H21BrN2O3
and a molecular weight of 297.19 g/mol. Its IUPAC name is 3-cyanopropyl-(2-hydroxyethyl)-dimethylazanium;acetate;hydrobromide.
Molecular Properties
| Compound Name | 3-cyanopropyl-(2-hydroxyethyl)-dimethylazanium;acetate;hydrobromide |
| PubChem CID | 23623162 |
| Molecular Formula | C10H21BrN2O3 |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 3-cyanopropyl-(2-hydroxyethyl)-dimethylazanium;acetate;hydrobromide |
| SMILES | Br.CC(=O)[O-].C[N+](C)(CCO)CCCC#N |
| InChI | InChI=1S/C8H17N2O.C2H4O2.BrH/c1-10(2,7-8-11)6-4-3-5-9;1-2(3)4;/h11H,3-4,6-8H2,1-2H3;1H3,(H,3,4);1H/q+1;;/p-1 |
| InChIKey | NMCRDEFTLXDUEG-UHFFFAOYSA-M |
| XLogP | -0.31 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-cyanopropyl-(2-hydroxyethyl)-dimethylazanium;acetate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyanopropyl-(2-hydroxyethyl)-dimethylazanium;acetate;hydrobromide?
The IUPAC name of 3-cyanopropyl-(2-hydroxyethyl)-dimethylazanium;acetate;hydrobromide (CID 23623162) is 3-cyanopropyl-(2-hydroxyethyl)-dimethylazanium;acetate;hydrobromide.
What is the SMILES notation for 3-cyanopropyl-(2-hydroxyethyl)-dimethylazanium;acetate;hydrobromide?
The canonical SMILES for 3-cyanopropyl-(2-hydroxyethyl)-dimethylazanium;acetate;hydrobromide is Br.CC(=O)[O-].C[N+](C)(CCO)CCCC#N.
What is the InChIKey of 3-cyanopropyl-(2-hydroxyethyl)-dimethylazanium;acetate;hydrobromide?
The InChIKey is NMCRDEFTLXDUEG-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H17N2O.C2H4O2.BrH/c1-10(2,7-8-11)6-4-3-5-9;1-2(3)4;/h11H,3-4,6-8H2,1-2H3;1H3,(H,3,4);1H/q+1;;/p-1.
What are the key properties of 3-cyanopropyl-(2-hydroxyethyl)-dimethylazanium;acetate;hydrobromide?
3-cyanopropyl-(2-hydroxyethyl)-dimethylazanium;acetate;hydrobromide has a molecular weight of 297.19 g/mol, XLogP of -0.31, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyanopropyl-(2-hydroxyethyl)-dimethylazanium;acetate;hydrobromide is sourced from PubChem (CID 23623162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).