C9H18BrN2O3- — CID 23623148
2-cyanoethyl-(2-hydroxyethyl)-dimethylazanium;acetate;bromide (PubChem CID 23623148) has the molecular formula C9H18BrN2O3- and a molecular weight of 282.16 g/mol. Its IUPAC name is 2-cyanoethyl-(2-hydroxyethyl)-dimethylazanium;acetate;bromide.
| Compound Name | 2-cyanoethyl-(2-hydroxyethyl)-dimethylazanium;acetate;bromide |
|---|---|
| PubChem CID | 23623148 |
| Molecular Formula | C9H18BrN2O3- |
| Molecular Weight | 282.16 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 2-cyanoethyl-(2-hydroxyethyl)-dimethylazanium;acetate;bromide |
| SMILES | CC(=O)[O-].C[N+](C)(CCO)CCC#N.[Br-] |
| InChI | InChI=1S/C7H15N2O.C2H4O2.BrH/c1-9(2,6-7-10)5-3-4-8;1-2(3)4;/h10H,3,5-7H2,1-2H3;1H3,(H,3,4);1H/q+1;;/p-2 |
| InChIKey | CYDFKJUGJZOZMR-UHFFFAOYSA-L |
| XLogP | -4.27 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.16 |
| LogP ≤ 5 | -4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|