C27H26O4 — CID 174982065
4-[2-[3-[(2,3-dimethoxyphenyl)methylidene]-1,2-dihydroinden-4-yl]ethyl]benzoic acid (PubChem CID 174982065) has the molecular formula C27H26O4 and a molecular weight of 414.50 g/mol. Its IUPAC name is 4-[2-[3-[(2,3-dimethoxyphenyl)methylidene]-1,2-dihydroinden-4-yl]ethyl]benzoic acid.
| Compound Name | 4-[2-[3-[(2,3-dimethoxyphenyl)methylidene]-1,2-dihydroinden-4-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 174982065 |
| Molecular Formula | C27H26O4 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 4-[2-[3-[(2,3-dimethoxyphenyl)methylidene]-1,2-dihydroinden-4-yl]ethyl]benzoic acid |
| SMILES | COc1cccc(C=C2CCc3cccc(CCc4ccc(C(=O)O)cc4)c32)c1OC |
| InChI | InChI=1S/C27H26O4/c1-30-24-8-4-7-23(26(24)31-2)17-22-16-15-20-6-3-5-19(25(20)22)12-9-18-10-13-21(14-11-18)27(28)29/h3-8,10-11,13-14,17H,9,12,15-16H2,1-2H3,(H,28,29) |
| InChIKey | QMCMSIRTWAQWTN-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|