C14H22O7 — CID 174990393
dimethoxymethoxy(dimethoxy)methane;4-ethenylbenzene-1,3-diol (PubChem CID 174990393) has the molecular formula C14H22O7 and a molecular weight of 302.32 g/mol. Its IUPAC name is dimethoxymethoxy(dimethoxy)methane;4-ethenylbenzene-1,3-diol.
| Compound Name | dimethoxymethoxy(dimethoxy)methane;4-ethenylbenzene-1,3-diol |
|---|---|
| PubChem CID | 174990393 |
| Molecular Formula | C14H22O7 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | dimethoxymethoxy(dimethoxy)methane;4-ethenylbenzene-1,3-diol |
| SMILES | C=Cc1ccc(O)cc1O.COC(OC)OC(OC)OC |
| InChI | InChI=1S/C8H8O2.C6H14O5/c1-2-6-3-4-7(9)5-8(6)10;1-7-5(8-2)11-6(9-3)10-4/h2-5,9-10H,1H2;5-6H,1-4H3 |
| InChIKey | JOVSKFWIOLLLEM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|