About [(2S)-3-(4-acetylpiperazin-1-yl)-2-hydroxypropyl] N-tert-butylcarbamate
[(2S)-3-(4-acetylpiperazin-1-yl)-2-hydroxypropyl] N-tert-butylcarbamate (PubChem CID 174990709) has the molecular formula C14H27N3O4
and a molecular weight of 301.39 g/mol. Its IUPAC name is [(2S)-3-(4-acetylpiperazin-1-yl)-2-hydroxypropyl] N-tert-butylcarbamate.
Molecular Properties
| Compound Name | [(2S)-3-(4-acetylpiperazin-1-yl)-2-hydroxypropyl] N-tert-butylcarbamate |
| PubChem CID | 174990709 |
| Molecular Formula | C14H27N3O4 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | [(2S)-3-(4-acetylpiperazin-1-yl)-2-hydroxypropyl] N-tert-butylcarbamate |
| SMILES | CC(=O)N1CCN(C[C@H](O)COC(=O)NC(C)(C)C)CC1 |
| InChI | InChI=1S/C14H27N3O4/c1-11(18)17-7-5-16(6-8-17)9-12(19)10-21-13(20)15-14(2,3)4/h12,19H,5-10H2,1-4H3,(H,15,20)/t12-/m0/s1 |
| InChIKey | ITIVOCZPSHINDH-LBPRGKRZSA-N |
| XLogP | 0.04 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(2S)-3-(4-acetylpiperazin-1-yl)-2-hydroxypropyl] N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-3-(4-acetylpiperazin-1-yl)-2-hydroxypropyl] N-tert-butylcarbamate?
The IUPAC name of [(2S)-3-(4-acetylpiperazin-1-yl)-2-hydroxypropyl] N-tert-butylcarbamate (CID 174990709) is [(2S)-3-(4-acetylpiperazin-1-yl)-2-hydroxypropyl] N-tert-butylcarbamate.
What is the SMILES notation for [(2S)-3-(4-acetylpiperazin-1-yl)-2-hydroxypropyl] N-tert-butylcarbamate?
The canonical SMILES for [(2S)-3-(4-acetylpiperazin-1-yl)-2-hydroxypropyl] N-tert-butylcarbamate is CC(=O)N1CCN(C[C@H](O)COC(=O)NC(C)(C)C)CC1.
What is the InChIKey of [(2S)-3-(4-acetylpiperazin-1-yl)-2-hydroxypropyl] N-tert-butylcarbamate?
The InChIKey is ITIVOCZPSHINDH-LBPRGKRZSA-N. The full InChI is InChI=1S/C14H27N3O4/c1-11(18)17-7-5-16(6-8-17)9-12(19)10-21-13(20)15-14(2,3)4/h12,19H,5-10H2,1-4H3,(H,15,20)/t12-/m0/s1.
What are the key properties of [(2S)-3-(4-acetylpiperazin-1-yl)-2-hydroxypropyl] N-tert-butylcarbamate?
[(2S)-3-(4-acetylpiperazin-1-yl)-2-hydroxypropyl] N-tert-butylcarbamate has a molecular weight of 301.39 g/mol, XLogP of 0.04, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-3-(4-acetylpiperazin-1-yl)-2-hydroxypropyl] N-tert-butylcarbamate is sourced from PubChem (CID 174990709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).