C10H9F4NO4 — CID 174991977
2-[3-fluoro-4-(trifluoromethoxy)phenoxy]ethyl carbamate (PubChem CID 174991977) has the molecular formula C10H9F4NO4 and a molecular weight of 283.18 g/mol. Its IUPAC name is 2-[3-fluoro-4-(trifluoromethoxy)phenoxy]ethyl carbamate.
| Compound Name | 2-[3-fluoro-4-(trifluoromethoxy)phenoxy]ethyl carbamate |
|---|---|
| PubChem CID | 174991977 |
| Molecular Formula | C10H9F4NO4 |
| Molecular Weight | 283.18 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 2-[3-fluoro-4-(trifluoromethoxy)phenoxy]ethyl carbamate |
| SMILES | NC(=O)OCCOc1ccc(OC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C10H9F4NO4/c11-7-5-6(17-3-4-18-9(15)16)1-2-8(7)19-10(12,13)14/h1-2,5H,3-4H2,(H2,15,16) |
| InChIKey | TTWXNKLMVIVHQI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.18 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|