C28H36F4O2 — CID 20603151
2-fluoro-4-[8-[4-(4-methylcyclohexyl)phenyl]octoxy]-1-(trifluoromethoxy)benzene (PubChem CID 20603151) has the molecular formula C28H36F4O2 and a molecular weight of 480.59 g/mol. Its IUPAC name is 2-fluoro-4-[8-[4-(4-methylcyclohexyl)phenyl]octoxy]-1-(trifluoromethoxy)benzene.
| Compound Name | 2-fluoro-4-[8-[4-(4-methylcyclohexyl)phenyl]octoxy]-1-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 20603151 |
| Molecular Formula | C28H36F4O2 |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | 2-fluoro-4-[8-[4-(4-methylcyclohexyl)phenyl]octoxy]-1-(trifluoromethoxy)benzene |
| SMILES | CC1CCC(c2ccc(CCCCCCCCOc3ccc(OC(F)(F)F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C28H36F4O2/c1-21-9-13-23(14-10-21)24-15-11-22(12-16-24)8-6-4-2-3-5-7-19-33-25-17-18-27(26(29)20-25)34-28(30,31)32/h11-12,15-18,20-21,23H,2-10,13-14,19H2,1H3 |
| InChIKey | AJVGKUSFNRFVIB-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|