C22H36O7S — CID 174994128
4-methyl-2-[5-[2-[3-(oxan-2-yloxy)propoxy]ethoxy]pentyl]benzenesulfonic acid (PubChem CID 174994128) has the molecular formula C22H36O7S and a molecular weight of 444.59 g/mol. Its IUPAC name is 4-methyl-2-[5-[2-[3-(oxan-2-yloxy)propoxy]ethoxy]pentyl]benzenesulfonic acid.
| Compound Name | 4-methyl-2-[5-[2-[3-(oxan-2-yloxy)propoxy]ethoxy]pentyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 174994128 |
| Molecular Formula | C22H36O7S |
| Molecular Weight | 444.59 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 4-methyl-2-[5-[2-[3-(oxan-2-yloxy)propoxy]ethoxy]pentyl]benzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)c(CCCCCOCCOCCCOC2CCCCO2)c1 |
| InChI | InChI=1S/C22H36O7S/c1-19-10-11-21(30(23,24)25)20(18-19)8-3-2-5-12-26-16-17-27-13-7-15-29-22-9-4-6-14-28-22/h10-11,18,22H,2-9,12-17H2,1H3,(H,23,24,25) |
| InChIKey | RUHFHCURENRKOO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.59 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|