C17H26ClN3O3S — CID 174994435
[(3S)-3-[(5-chlorothiophene-2-carbonyl)amino]-1-(ethylamino)butyl] piperidine-1-carboxylate (PubChem CID 174994435) has the molecular formula C17H26ClN3O3S and a molecular weight of 387.93 g/mol. Its IUPAC name is [(3S)-3-[(5-chlorothiophene-2-carbonyl)amino]-1-(ethylamino)butyl] piperidine-1-carboxylate.
| Compound Name | [(3S)-3-[(5-chlorothiophene-2-carbonyl)amino]-1-(ethylamino)butyl] piperidine-1-carboxylate |
|---|---|
| PubChem CID | 174994435 |
| Molecular Formula | C17H26ClN3O3S |
| Molecular Weight | 387.93 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | [(3S)-3-[(5-chlorothiophene-2-carbonyl)amino]-1-(ethylamino)butyl] piperidine-1-carboxylate |
| SMILES | CCNC(C[C@H](C)NC(=O)c1ccc(Cl)s1)OC(=O)N1CCCCC1 |
| InChI | InChI=1S/C17H26ClN3O3S/c1-3-19-15(24-17(23)21-9-5-4-6-10-21)11-12(2)20-16(22)13-7-8-14(18)25-13/h7-8,12,15,19H,3-6,9-11H2,1-2H3,(H,20,22)/t12-,15?/m0/s1 |
| InChIKey | BQMYATMHBCIHMW-SFVWDYPZSA-N |
| XLogP | 3.47 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.93 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|