C22H44O6 — CID 174996100
6,13-bis(tert-butylperoxy)-4-methyltridecanoic acid (PubChem CID 174996100) has the molecular formula C22H44O6 and a molecular weight of 404.59 g/mol. Its IUPAC name is 6,13-bis(tert-butylperoxy)-4-methyltridecanoic acid.
| Compound Name | 6,13-bis(tert-butylperoxy)-4-methyltridecanoic acid |
|---|---|
| PubChem CID | 174996100 |
| Molecular Formula | C22H44O6 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.31 |
| IUPAC Name | 6,13-bis(tert-butylperoxy)-4-methyltridecanoic acid |
| SMILES | CC(CCC(=O)O)CC(CCCCCCCOOC(C)(C)C)OOC(C)(C)C |
| InChI | InChI=1S/C22H44O6/c1-18(14-15-20(23)24)17-19(26-28-22(5,6)7)13-11-9-8-10-12-16-25-27-21(2,3)4/h18-19H,8-17H2,1-7H3,(H,23,24) |
| InChIKey | XJXCSDDKTLUTEM-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|