C24H24N2O6 — CID 174996670
[(2R)-2-(1,3-dioxoisoindol-2-yl)-2-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)ethyl] N-tert-butylcarbamate (PubChem CID 174996670) has the molecular formula C24H24N2O6 and a molecular weight of 436.46 g/mol. Its IUPAC name is [(2R)-2-(1,3-dioxoisoindol-2-yl)-2-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)ethyl] N-tert-butylcarbamate.
| Compound Name | [(2R)-2-(1,3-dioxoisoindol-2-yl)-2-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)ethyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 174996670 |
| Molecular Formula | C24H24N2O6 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | [(2R)-2-(1,3-dioxoisoindol-2-yl)-2-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)ethyl] N-tert-butylcarbamate |
| SMILES | Cc1c([C@H](COC(=O)NC(C)(C)C)N2C(=O)c3ccccc3C2=O)ccc2c1COC2=O |
| InChI | InChI=1S/C24H24N2O6/c1-13-14(9-10-17-18(13)11-31-22(17)29)19(12-32-23(30)25-24(2,3)4)26-20(27)15-7-5-6-8-16(15)21(26)28/h5-10,19H,11-12H2,1-4H3,(H,25,30)/t19-/m0/s1 |
| InChIKey | ZOYYEPAQMRWBAX-IBGZPJMESA-N |
| XLogP | 3.53 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|