C52H103NO5 — CID 174997394
8-[7-carboxyheptyl(4-hydroxybutyl)amino]-10-hexyl-8-(2-hexyldecyl)octadecanoic acid (PubChem CID 174997394) has the molecular formula C52H103NO5 and a molecular weight of 822.40 g/mol. Its IUPAC name is 8-[7-carboxyheptyl(4-hydroxybutyl)amino]-10-hexyl-8-(2-hexyldecyl)octadecanoic acid.
| Compound Name | 8-[7-carboxyheptyl(4-hydroxybutyl)amino]-10-hexyl-8-(2-hexyldecyl)octadecanoic acid |
|---|---|
| PubChem CID | 174997394 |
| Molecular Formula | C52H103NO5 |
| Molecular Weight | 822.40 g/mol |
| Exact Mass | 821.78 |
| IUPAC Name | 8-[7-carboxyheptyl(4-hydroxybutyl)amino]-10-hexyl-8-(2-hexyldecyl)octadecanoic acid |
| SMILES | CCCCCCCCC(CCCCCC)CC(CCCCCCC(=O)O)(CC(CCCCCC)CCCCCCCC)N(CCCCO)CCCCCCCC(=O)O |
| InChI | InChI=1S/C52H103NO5/c1-5-9-13-17-20-28-38-48(36-26-15-11-7-3)46-52(42-32-24-23-31-41-51(57)58,47-49(37-27-16-12-8-4)39-29-21-18-14-10-6-2)53(44-34-35-45-54)43-33-25-19-22-30-40-50(55)56/h48-49,54H,5-47H2,1-4H3,(H,55,56)(H,57,58) |
| InChIKey | QCHMAIDEWYGHQV-UHFFFAOYSA-N |
| XLogP | 16.10 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.40 |
| LogP ≤ 5 | 16.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|