C16H15Cl3N2O2 — CID 174997931
2,4-dichloro-3-[2-[(2-chloro-3-pyridinyl)methylamino]propyl]benzoic acid (PubChem CID 174997931) has the molecular formula C16H15Cl3N2O2 and a molecular weight of 373.67 g/mol. Its IUPAC name is 2,4-dichloro-3-[2-[(2-chloro-3-pyridinyl)methylamino]propyl]benzoic acid.
| Compound Name | 2,4-dichloro-3-[2-[(2-chloro-3-pyridinyl)methylamino]propyl]benzoic acid |
|---|---|
| PubChem CID | 174997931 |
| Molecular Formula | C16H15Cl3N2O2 |
| Molecular Weight | 373.67 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | 2,4-dichloro-3-[2-[(2-chloro-3-pyridinyl)methylamino]propyl]benzoic acid |
| SMILES | CC(Cc1c(Cl)ccc(C(=O)O)c1Cl)NCc1cccnc1Cl |
| InChI | InChI=1S/C16H15Cl3N2O2/c1-9(21-8-10-3-2-6-20-15(10)19)7-12-13(17)5-4-11(14(12)18)16(22)23/h2-6,9,21H,7-8H2,1H3,(H,22,23) |
| InChIKey | HMJMDTJUASXSGU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.67 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|