C15H12Cl3NO2 — CID 174989966
2,4-dichloro-3-[3-(2-chloro-3-pyridinyl)propyl]benzoic acid (PubChem CID 174989966) has the molecular formula C15H12Cl3NO2 and a molecular weight of 344.62 g/mol. Its IUPAC name is 2,4-dichloro-3-[3-(2-chloro-3-pyridinyl)propyl]benzoic acid.
| Compound Name | 2,4-dichloro-3-[3-(2-chloro-3-pyridinyl)propyl]benzoic acid |
|---|---|
| PubChem CID | 174989966 |
| Molecular Formula | C15H12Cl3NO2 |
| Molecular Weight | 344.62 g/mol |
| Exact Mass | 342.99 |
| IUPAC Name | 2,4-dichloro-3-[3-(2-chloro-3-pyridinyl)propyl]benzoic acid |
| SMILES | O=C(O)c1ccc(Cl)c(CCCc2cccnc2Cl)c1Cl |
| InChI | InChI=1S/C15H12Cl3NO2/c16-12-7-6-11(15(20)21)13(17)10(12)5-1-3-9-4-2-8-19-14(9)18/h2,4,6-8H,1,3,5H2,(H,20,21) |
| InChIKey | WUUHWOHCJFQHFW-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.62 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|