C18H21ClN2O3 — CID 174998619
cyanomethyl 4-(3-chlorophenyl)-2-[methyl(pent-4-enoyl)amino]butanoate (PubChem CID 174998619) has the molecular formula C18H21ClN2O3 and a molecular weight of 348.83 g/mol. Its IUPAC name is cyanomethyl 4-(3-chlorophenyl)-2-[methyl(pent-4-enoyl)amino]butanoate.
| Compound Name | cyanomethyl 4-(3-chlorophenyl)-2-[methyl(pent-4-enoyl)amino]butanoate |
|---|---|
| PubChem CID | 174998619 |
| Molecular Formula | C18H21ClN2O3 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | cyanomethyl 4-(3-chlorophenyl)-2-[methyl(pent-4-enoyl)amino]butanoate |
| SMILES | C=CCCC(=O)N(C)C(CCc1cccc(Cl)c1)C(=O)OCC#N |
| InChI | InChI=1S/C18H21ClN2O3/c1-3-4-8-17(22)21(2)16(18(23)24-12-11-20)10-9-14-6-5-7-15(19)13-14/h3,5-7,13,16H,1,4,8-10,12H2,2H3 |
| InChIKey | KTQXRHOFOOWHGN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|