About N-(4-cyanophenyl)formamide;4-methylpiperidine
N-(4-cyanophenyl)formamide;4-methylpiperidine (PubChem CID 175001445) has the molecular formula C14H19N3O
and a molecular weight of 245.33 g/mol. Its IUPAC name is N-(4-cyanophenyl)formamide;4-methylpiperidine.
Molecular Properties
| Compound Name | N-(4-cyanophenyl)formamide;4-methylpiperidine |
| PubChem CID | 175001445 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | N-(4-cyanophenyl)formamide;4-methylpiperidine |
| SMILES | CC1CCNCC1.N#Cc1ccc(NC=O)cc1 |
| InChI | InChI=1S/C8H6N2O.C6H13N/c9-5-7-1-3-8(4-2-7)10-6-11;1-6-2-4-7-5-3-6/h1-4,6H,(H,10,11);6-7H,2-5H2,1H3 |
| InChIKey | AGNDMVMZTWCYES-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(4-cyanophenyl)formamide;4-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-cyanophenyl)formamide;4-methylpiperidine?
The IUPAC name of N-(4-cyanophenyl)formamide;4-methylpiperidine (CID 175001445) is N-(4-cyanophenyl)formamide;4-methylpiperidine.
What is the SMILES notation for N-(4-cyanophenyl)formamide;4-methylpiperidine?
The canonical SMILES for N-(4-cyanophenyl)formamide;4-methylpiperidine is CC1CCNCC1.N#Cc1ccc(NC=O)cc1.
What is the InChIKey of N-(4-cyanophenyl)formamide;4-methylpiperidine?
The InChIKey is AGNDMVMZTWCYES-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O.C6H13N/c9-5-7-1-3-8(4-2-7)10-6-11;1-6-2-4-7-5-3-6/h1-4,6H,(H,10,11);6-7H,2-5H2,1H3.
What are the key properties of N-(4-cyanophenyl)formamide;4-methylpiperidine?
N-(4-cyanophenyl)formamide;4-methylpiperidine has a molecular weight of 245.33 g/mol, XLogP of 2.13, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-cyanophenyl)formamide;4-methylpiperidine is sourced from PubChem (CID 175001445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).