C22H14O4 — CID 175006474
5-anthracen-1-ylbenzene-1,3-dicarboxylic acid (PubChem CID 175006474) has the molecular formula C22H14O4 and a molecular weight of 342.35 g/mol. Its IUPAC name is 5-anthracen-1-ylbenzene-1,3-dicarboxylic acid.
| Compound Name | 5-anthracen-1-ylbenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 175006474 |
| Molecular Formula | C22H14O4 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 5-anthracen-1-ylbenzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)cc(-c2cccc3cc4ccccc4cc23)c1 |
| InChI | InChI=1S/C22H14O4/c23-21(24)17-9-16(10-18(11-17)22(25)26)19-7-3-6-15-8-13-4-1-2-5-14(13)12-20(15)19/h1-12H,(H,23,24)(H,25,26) |
| InChIKey | SYTXOTUCEFLCDZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|