About chloro butanoate;silver
chloro butanoate;silver (PubChem CID 175006777) has the molecular formula C4H7AgClO2
and a molecular weight of 230.42 g/mol. Its IUPAC name is chloro butanoate;silver.
Molecular Properties
| Compound Name | chloro butanoate;silver |
| PubChem CID | 175006777 |
| Molecular Formula | C4H7AgClO2 |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 228.92 |
| IUPAC Name | chloro butanoate;silver |
| SMILES | CCCC(=O)OCl.[Ag] |
| InChI | InChI=1S/C4H7ClO2.Ag/c1-2-3-4(6)7-5;/h2-3H2,1H3; |
| InChIKey | LXBQHZZFMGEQIV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze chloro butanoate;silver with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro butanoate;silver?
The IUPAC name of chloro butanoate;silver (CID 175006777) is chloro butanoate;silver.
What is the SMILES notation for chloro butanoate;silver?
The canonical SMILES for chloro butanoate;silver is CCCC(=O)OCl.[Ag].
What is the InChIKey of chloro butanoate;silver?
The InChIKey is LXBQHZZFMGEQIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7ClO2.Ag/c1-2-3-4(6)7-5;/h2-3H2,1H3;.
What are the key properties of chloro butanoate;silver?
chloro butanoate;silver has a molecular weight of 230.42 g/mol, XLogP of 1.48, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloro butanoate;silver is sourced from PubChem (CID 175006777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).