C19H19N3O3 — CID 175009893
(3-aminophenyl)-[2-(4,4-diamino-3,3-dihydroxycyclohexa-1,5-dien-1-yl)phenyl]methanone (PubChem CID 175009893) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is (3-aminophenyl)-[2-(4,4-diamino-3,3-dihydroxycyclohexa-1,5-dien-1-yl)phenyl]methanone.
| Compound Name | (3-aminophenyl)-[2-(4,4-diamino-3,3-dihydroxycyclohexa-1,5-dien-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 175009893 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | (3-aminophenyl)-[2-(4,4-diamino-3,3-dihydroxycyclohexa-1,5-dien-1-yl)phenyl]methanone |
| SMILES | Nc1cccc(C(=O)c2ccccc2C2=CC(O)(O)C(N)(N)C=C2)c1 |
| InChI | InChI=1S/C19H19N3O3/c20-14-5-3-4-12(10-14)17(23)16-7-2-1-6-15(16)13-8-9-18(21,22)19(24,25)11-13/h1-11,24-25H,20-22H2 |
| InChIKey | UBRWWTJNHYPFSU-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 135.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|