C17H30N4O2 — CID 175014622
N-(1,6-diethyl-4-oxotriazin-5-yl)decanamide (PubChem CID 175014622) has the molecular formula C17H30N4O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is N-(1,6-diethyl-4-oxotriazin-5-yl)decanamide.
| Compound Name | N-(1,6-diethyl-4-oxotriazin-5-yl)decanamide |
|---|---|
| PubChem CID | 175014622 |
| Molecular Formula | C17H30N4O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | N-(1,6-diethyl-4-oxotriazin-5-yl)decanamide |
| SMILES | CCCCCCCCCC(=O)Nc1c(CC)n(CC)nnc1=O |
| InChI | InChI=1S/C17H30N4O2/c1-4-7-8-9-10-11-12-13-15(22)18-16-14(5-2)21(6-3)20-19-17(16)23/h4-13H2,1-3H3,(H,18,22) |
| InChIKey | DSMWWIVWRAYBMS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|