C17H30F6O8S2 — CID 175014648
1,1,1-trifluoro-5-hydroxy-5-(2-hydroxyethyl)-4-propyl-6-(trifluoromethyl)undecane-2,6-disulfonic acid (PubChem CID 175014648) has the molecular formula C17H30F6O8S2 and a molecular weight of 540.54 g/mol. Its IUPAC name is 1,1,1-trifluoro-5-hydroxy-5-(2-hydroxyethyl)-4-propyl-6-(trifluoromethyl)undecane-2,6-disulfonic acid.
| Compound Name | 1,1,1-trifluoro-5-hydroxy-5-(2-hydroxyethyl)-4-propyl-6-(trifluoromethyl)undecane-2,6-disulfonic acid |
|---|---|
| PubChem CID | 175014648 |
| Molecular Formula | C17H30F6O8S2 |
| Molecular Weight | 540.54 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | 1,1,1-trifluoro-5-hydroxy-5-(2-hydroxyethyl)-4-propyl-6-(trifluoromethyl)undecane-2,6-disulfonic acid |
| SMILES | CCCCCC(C(F)(F)F)(C(O)(CCO)C(CCC)CC(C(F)(F)F)S(=O)(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C17H30F6O8S2/c1-3-5-6-8-15(17(21,22)23,33(29,30)31)14(25,9-10-24)12(7-4-2)11-13(16(18,19)20)32(26,27)28/h12-13,24-25H,3-11H2,1-2H3,(H,26,27,28)(H,29,30,31) |
| InChIKey | DSIQWIIUPDJWIQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.54 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|