C14H24F6O6S2 — CID 90922926
1,1,1-trifluoro-6-(trifluoromethyl)tridecane-2,6-disulfonic acid (PubChem CID 90922926) has the molecular formula C14H24F6O6S2 and a molecular weight of 466.46 g/mol. Its IUPAC name is 1,1,1-trifluoro-6-(trifluoromethyl)tridecane-2,6-disulfonic acid.
| Compound Name | 1,1,1-trifluoro-6-(trifluoromethyl)tridecane-2,6-disulfonic acid |
|---|---|
| PubChem CID | 90922926 |
| Molecular Formula | C14H24F6O6S2 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | 1,1,1-trifluoro-6-(trifluoromethyl)tridecane-2,6-disulfonic acid |
| SMILES | CCCCCCCC(CCCC(C(F)(F)F)S(=O)(=O)O)(C(F)(F)F)S(=O)(=O)O |
| InChI | InChI=1S/C14H24F6O6S2/c1-2-3-4-5-6-9-12(14(18,19)20,28(24,25)26)10-7-8-11(13(15,16)17)27(21,22)23/h11H,2-10H2,1H3,(H,21,22,23)(H,24,25,26) |
| InChIKey | WBWIYHOXEWSRRI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|