C16H24N2O5 — CID 175015986
methyl 2-amino-4-methoxy-5-(1-morpholin-3-ylpropoxy)benzoate (PubChem CID 175015986) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is methyl 2-amino-4-methoxy-5-(1-morpholin-3-ylpropoxy)benzoate.
| Compound Name | methyl 2-amino-4-methoxy-5-(1-morpholin-3-ylpropoxy)benzoate |
|---|---|
| PubChem CID | 175015986 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | methyl 2-amino-4-methoxy-5-(1-morpholin-3-ylpropoxy)benzoate |
| SMILES | CCC(Oc1cc(C(=O)OC)c(N)cc1OC)C1COCCN1 |
| InChI | InChI=1S/C16H24N2O5/c1-4-13(12-9-22-6-5-18-12)23-15-7-10(16(19)21-3)11(17)8-14(15)20-2/h7-8,12-13,18H,4-6,9,17H2,1-3H3 |
| InChIKey | HJNUCYLJDJDIEE-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|