C32H30BrCl3N2O3 — CID 175016396
5-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)-tert-butylamino]-4-(2,3,6-trichlorophenyl)pentanoic acid (PubChem CID 175016396) has the molecular formula C32H30BrCl3N2O3 and a molecular weight of 676.87 g/mol. Its IUPAC name is 5-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)-tert-butylamino]-4-(2,3,6-trichlorophenyl)pentanoic acid.
| Compound Name | 5-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)-tert-butylamino]-4-(2,3,6-trichlorophenyl)pentanoic acid |
|---|---|
| PubChem CID | 175016396 |
| Molecular Formula | C32H30BrCl3N2O3 |
| Molecular Weight | 676.87 g/mol |
| Exact Mass | 674.05 |
| IUPAC Name | 5-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)-tert-butylamino]-4-(2,3,6-trichlorophenyl)pentanoic acid |
| SMILES | Cc1c(-c2ccccc2)nc2ccc(Br)cc2c1C(=O)N(CC(CCC(=O)O)c1c(Cl)ccc(Cl)c1Cl)C(C)(C)C |
| InChI | InChI=1S/C32H30BrCl3N2O3/c1-18-27(22-16-21(33)11-14-25(22)37-30(18)19-8-6-5-7-9-19)31(41)38(32(2,3)4)17-20(10-15-26(39)40)28-23(34)12-13-24(35)29(28)36/h5-9,11-14,16,20H,10,15,17H2,1-4H3,(H,39,40) |
| InChIKey | NEEBFNARGMPTMC-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.87 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|