C14H11F3O3 — CID 175017889
2-[4-(3,4,5-trifluorophenoxy)phenyl]ethane-1,1-diol (PubChem CID 175017889) has the molecular formula C14H11F3O3 and a molecular weight of 284.23 g/mol. Its IUPAC name is 2-[4-(3,4,5-trifluorophenoxy)phenyl]ethane-1,1-diol.
| Compound Name | 2-[4-(3,4,5-trifluorophenoxy)phenyl]ethane-1,1-diol |
|---|---|
| PubChem CID | 175017889 |
| Molecular Formula | C14H11F3O3 |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 2-[4-(3,4,5-trifluorophenoxy)phenyl]ethane-1,1-diol |
| SMILES | OC(O)Cc1ccc(Oc2cc(F)c(F)c(F)c2)cc1 |
| InChI | InChI=1S/C14H11F3O3/c15-11-6-10(7-12(16)14(11)17)20-9-3-1-8(2-4-9)5-13(18)19/h1-4,6-7,13,18-19H,5H2 |
| InChIKey | USJASTMFEJSRJY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|