C17H19O3P — CID 175018654
(2-methyl-4,4-diphenylbut-2-enyl) dihydrogen phosphite (PubChem CID 175018654) has the molecular formula C17H19O3P and a molecular weight of 302.31 g/mol. Its IUPAC name is (2-methyl-4,4-diphenylbut-2-enyl) dihydrogen phosphite.
| Compound Name | (2-methyl-4,4-diphenylbut-2-enyl) dihydrogen phosphite |
|---|---|
| PubChem CID | 175018654 |
| Molecular Formula | C17H19O3P |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | (2-methyl-4,4-diphenylbut-2-enyl) dihydrogen phosphite |
| SMILES | CC(=CC(c1ccccc1)c1ccccc1)COP(O)O |
| InChI | InChI=1S/C17H19O3P/c1-14(13-20-21(18)19)12-17(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-12,17-19H,13H2,1H3 |
| InChIKey | GUULNGRHQZNLRF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|