C15H26O8P2 — CID 54107568
2-[3-(2-dihydroxyphosphanyloxyethoxy)-2,2-dimethyl-1-phenylpropoxy]ethyl dihydrogen phosphite (PubChem CID 54107568) has the molecular formula C15H26O8P2 and a molecular weight of 396.31 g/mol. Its IUPAC name is 2-[3-(2-dihydroxyphosphanyloxyethoxy)-2,2-dimethyl-1-phenylpropoxy]ethyl dihydrogen phosphite.
| Compound Name | 2-[3-(2-dihydroxyphosphanyloxyethoxy)-2,2-dimethyl-1-phenylpropoxy]ethyl dihydrogen phosphite |
|---|---|
| PubChem CID | 54107568 |
| Molecular Formula | C15H26O8P2 |
| Molecular Weight | 396.31 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 2-[3-(2-dihydroxyphosphanyloxyethoxy)-2,2-dimethyl-1-phenylpropoxy]ethyl dihydrogen phosphite |
| SMILES | CC(C)(COCCOP(O)O)C(OCCOP(O)O)c1ccccc1 |
| InChI | InChI=1S/C15H26O8P2/c1-15(2,12-20-8-10-22-24(16)17)14(13-6-4-3-5-7-13)21-9-11-23-25(18)19/h3-7,14,16-19H,8-12H2,1-2H3 |
| InChIKey | NEVGIOLTWOCWAY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|