About methanolate;tetrapyrrolidin-1-ylphosphanium
methanolate;tetrapyrrolidin-1-ylphosphanium (PubChem CID 175019090) has the molecular formula C17H35N4OP
and a molecular weight of 342.47 g/mol. Its IUPAC name is methanolate;tetrapyrrolidin-1-ylphosphanium.
Molecular Properties
| Compound Name | methanolate;tetrapyrrolidin-1-ylphosphanium |
| PubChem CID | 175019090 |
| Molecular Formula | C17H35N4OP |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.25 |
| IUPAC Name | methanolate;tetrapyrrolidin-1-ylphosphanium |
| SMILES | C1CCN([P+](N2CCCC2)(N2CCCC2)N2CCCC2)C1.C[O-] |
| InChI | InChI=1S/C16H32N4P.CH3O/c1-2-10-17(9-1)21(18-11-3-4-12-18,19-13-5-6-14-19)20-15-7-8-16-20;1-2/h1-16H2;1H3/q+1;-1 |
| InChIKey | ZPSUHWOTMSHWPS-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methanolate;tetrapyrrolidin-1-ylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanolate;tetrapyrrolidin-1-ylphosphanium?
The IUPAC name of methanolate;tetrapyrrolidin-1-ylphosphanium (CID 175019090) is methanolate;tetrapyrrolidin-1-ylphosphanium.
What is the SMILES notation for methanolate;tetrapyrrolidin-1-ylphosphanium?
The canonical SMILES for methanolate;tetrapyrrolidin-1-ylphosphanium is C1CCN([P+](N2CCCC2)(N2CCCC2)N2CCCC2)C1.C[O-].
What is the InChIKey of methanolate;tetrapyrrolidin-1-ylphosphanium?
The InChIKey is ZPSUHWOTMSHWPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32N4P.CH3O/c1-2-10-17(9-1)21(18-11-3-4-12-18,19-13-5-6-14-19)20-15-7-8-16-20;1-2/h1-16H2;1H3/q+1;-1.
What are the key properties of methanolate;tetrapyrrolidin-1-ylphosphanium?
methanolate;tetrapyrrolidin-1-ylphosphanium has a molecular weight of 342.47 g/mol, XLogP of 2.02, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methanolate;tetrapyrrolidin-1-ylphosphanium is sourced from PubChem (CID 175019090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).