C10H11ClN2O4 — CID 175023396
[1-(3-carbamoyl-4-chlorophenyl)-2-hydroxyethyl] carbamate (PubChem CID 175023396) has the molecular formula C10H11ClN2O4 and a molecular weight of 258.66 g/mol. Its IUPAC name is [1-(3-carbamoyl-4-chlorophenyl)-2-hydroxyethyl] carbamate.
| Compound Name | [1-(3-carbamoyl-4-chlorophenyl)-2-hydroxyethyl] carbamate |
|---|---|
| PubChem CID | 175023396 |
| Molecular Formula | C10H11ClN2O4 |
| Molecular Weight | 258.66 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | [1-(3-carbamoyl-4-chlorophenyl)-2-hydroxyethyl] carbamate |
| SMILES | NC(=O)OC(CO)c1ccc(Cl)c(C(N)=O)c1 |
| InChI | InChI=1S/C10H11ClN2O4/c11-7-2-1-5(3-6(7)9(12)15)8(4-14)17-10(13)16/h1-3,8,14H,4H2,(H2,12,15)(H2,13,16) |
| InChIKey | INBQILDCZGWSLX-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.66 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |