C13H15ClFNO5 — CID 89422342
[1-(3-acetyl-5-chloro-2-ethoxy-6-fluorophenyl)-2-hydroxyethyl] carbamate (PubChem CID 89422342) has the molecular formula C13H15ClFNO5 and a molecular weight of 319.72 g/mol. Its IUPAC name is [1-(3-acetyl-5-chloro-2-ethoxy-6-fluorophenyl)-2-hydroxyethyl] carbamate.
| Compound Name | [1-(3-acetyl-5-chloro-2-ethoxy-6-fluorophenyl)-2-hydroxyethyl] carbamate |
|---|---|
| PubChem CID | 89422342 |
| Molecular Formula | C13H15ClFNO5 |
| Molecular Weight | 319.72 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | [1-(3-acetyl-5-chloro-2-ethoxy-6-fluorophenyl)-2-hydroxyethyl] carbamate |
| SMILES | CCOc1c(C(C)=O)cc(Cl)c(F)c1C(CO)OC(N)=O |
| InChI | InChI=1S/C13H15ClFNO5/c1-3-20-12-7(6(2)18)4-8(14)11(15)10(12)9(5-17)21-13(16)19/h4,9,17H,3,5H2,1-2H3,(H2,16,19) |
| InChIKey | GAQSIPUZTPEBEX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.72 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |