C20H33ClFNO2Si — CID 90385086
1-[3-[1-amino-4-[tert-butyl(dimethyl)silyl]butyl]-5-chloro-2-ethoxy-4-fluorophenyl]ethanone (PubChem CID 90385086) has the molecular formula C20H33ClFNO2Si and a molecular weight of 402.03 g/mol. Its IUPAC name is 1-[3-[1-amino-4-[tert-butyl(dimethyl)silyl]butyl]-5-chloro-2-ethoxy-4-fluorophenyl]ethanone.
| Compound Name | 1-[3-[1-amino-4-[tert-butyl(dimethyl)silyl]butyl]-5-chloro-2-ethoxy-4-fluorophenyl]ethanone |
|---|---|
| PubChem CID | 90385086 |
| Molecular Formula | C20H33ClFNO2Si |
| Molecular Weight | 402.03 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 1-[3-[1-amino-4-[tert-butyl(dimethyl)silyl]butyl]-5-chloro-2-ethoxy-4-fluorophenyl]ethanone |
| SMILES | CCOc1c(C(C)=O)cc(Cl)c(F)c1C(N)CCC[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H33ClFNO2Si/c1-8-25-19-14(13(2)24)12-15(21)18(22)17(19)16(23)10-9-11-26(6,7)20(3,4)5/h12,16H,8-11,23H2,1-7H3 |
| InChIKey | CJLIXNTZOVONOP-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.03 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|