C10H9Cl2N5O2 — CID 11962451
[(1R)-1-(3,4-dichlorophenyl)-2-(tetrazol-2-yl)ethyl] carbamate (PubChem CID 11962451) has the molecular formula C10H9Cl2N5O2 and a molecular weight of 302.12 g/mol. Its IUPAC name is [(1R)-1-(3,4-dichlorophenyl)-2-(tetrazol-2-yl)ethyl] carbamate.
| Compound Name | [(1R)-1-(3,4-dichlorophenyl)-2-(tetrazol-2-yl)ethyl] carbamate |
|---|---|
| PubChem CID | 11962451 |
| Molecular Formula | C10H9Cl2N5O2 |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | [(1R)-1-(3,4-dichlorophenyl)-2-(tetrazol-2-yl)ethyl] carbamate |
| SMILES | NC(=O)O[C@@H](Cn1ncnn1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H9Cl2N5O2/c11-7-2-1-6(3-8(7)12)9(19-10(13)18)4-17-15-5-14-16-17/h1-3,5,9H,4H2,(H2,13,18)/t9-/m0/s1 |
| InChIKey | TWIUABQBIFTFTG-VIFPVBQESA-N |
| XLogP | 1.82 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |