C11H12ClN3O5 — CID 22940933
carbamoyl N-[(2S)-2-carbamoyloxy-2-(4-chlorophenyl)ethyl]carbamate (PubChem CID 22940933) has the molecular formula C11H12ClN3O5 and a molecular weight of 301.69 g/mol. Its IUPAC name is carbamoyl N-[(2S)-2-carbamoyloxy-2-(4-chlorophenyl)ethyl]carbamate.
| Compound Name | carbamoyl N-[(2S)-2-carbamoyloxy-2-(4-chlorophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 22940933 |
| Molecular Formula | C11H12ClN3O5 |
| Molecular Weight | 301.69 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | carbamoyl N-[(2S)-2-carbamoyloxy-2-(4-chlorophenyl)ethyl]carbamate |
| SMILES | NC(=O)OC(=O)NC[C@@H](OC(N)=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H12ClN3O5/c12-7-3-1-6(2-4-7)8(19-9(13)16)5-15-11(18)20-10(14)17/h1-4,8H,5H2,(H2,13,16)(H2,14,17)(H,15,18)/t8-/m1/s1 |
| InChIKey | PLQVWTRPXGJQEN-MRVPVSSYSA-N |
| XLogP | 1.28 |
| TPSA | 133.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.69 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|