C9H8Cl3N3O5S — CID 22598073
carbamoyl N-[2-carbamoyloxy-2-(3,4,5-trichlorothiophen-2-yl)ethyl]carbamate (PubChem CID 22598073) has the molecular formula C9H8Cl3N3O5S and a molecular weight of 376.61 g/mol. Its IUPAC name is carbamoyl N-[2-carbamoyloxy-2-(3,4,5-trichlorothiophen-2-yl)ethyl]carbamate.
| Compound Name | carbamoyl N-[2-carbamoyloxy-2-(3,4,5-trichlorothiophen-2-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 22598073 |
| Molecular Formula | C9H8Cl3N3O5S |
| Molecular Weight | 376.61 g/mol |
| Exact Mass | 374.93 |
| IUPAC Name | carbamoyl N-[2-carbamoyloxy-2-(3,4,5-trichlorothiophen-2-yl)ethyl]carbamate |
| SMILES | NC(=O)OC(=O)NCC(OC(N)=O)c1sc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C9H8Cl3N3O5S/c10-3-4(11)6(12)21-5(3)2(19-7(13)16)1-15-9(18)20-8(14)17/h2H,1H2,(H2,13,16)(H2,14,17)(H,15,18) |
| InChIKey | LTVHKQVMRJGAII-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 133.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.61 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|