C22H30O6Zn — CID 175024070
zinc bis(6-butoxycyclohexa-2,4-diene-1-carboxylate) (PubChem CID 175024070) has the molecular formula C22H30O6Zn and a molecular weight of 455.87 g/mol. Its IUPAC name is zinc bis(6-butoxycyclohexa-2,4-diene-1-carboxylate).
| Compound Name | zinc bis(6-butoxycyclohexa-2,4-diene-1-carboxylate) |
|---|---|
| PubChem CID | 175024070 |
| Molecular Formula | C22H30O6Zn |
| Molecular Weight | 455.87 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | zinc bis(6-butoxycyclohexa-2,4-diene-1-carboxylate) |
| SMILES | CCCCOC1C=CC=CC1C(=O)[O-].CCCCOC1C=CC=CC1C(=O)[O-].[Zn+2] |
| InChI | InChI=1S/2C11H16O3.Zn/c2*1-2-3-8-14-10-7-5-4-6-9(10)11(12)13;/h2*4-7,9-10H,2-3,8H2,1H3,(H,12,13);/q;;+2/p-2 |
| InChIKey | ZJBYWWUKHOPTCI-UHFFFAOYSA-L |
| XLogP | 1.33 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.87 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|