About zinc bis(6-butoxycyclohexa-2,4-diene-1-carboxylate)
zinc bis(6-butoxycyclohexa-2,4-diene-1-carboxylate) (PubChem CID 175024070) has the molecular formula C22H30O6Zn
and a molecular weight of 455.87 g/mol. Its IUPAC name is zinc bis(6-butoxycyclohexa-2,4-diene-1-carboxylate).
Molecular Properties
| Compound Name | zinc bis(6-butoxycyclohexa-2,4-diene-1-carboxylate) |
| PubChem CID | 175024070 |
| Molecular Formula | C22H30O6Zn |
| Molecular Weight | 455.87 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | zinc bis(6-butoxycyclohexa-2,4-diene-1-carboxylate) |
| SMILES | CCCCOC1C=CC=CC1C(=O)[O-].CCCCOC1C=CC=CC1C(=O)[O-].[Zn+2] |
| InChI | InChI=1S/2C11H16O3.Zn/c2*1-2-3-8-14-10-7-5-4-6-9(10)11(12)13;/h2*4-7,9-10H,2-3,8H2,1H3,(H,12,13);/q;;+2/p-2 |
| InChIKey | ZJBYWWUKHOPTCI-UHFFFAOYSA-L |
| XLogP | 1.33 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 455.87 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc bis(6-butoxycyclohexa-2,4-diene-1-carboxylate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc bis(6-butoxycyclohexa-2,4-diene-1-carboxylate)?
The IUPAC name of zinc bis(6-butoxycyclohexa-2,4-diene-1-carboxylate) (CID 175024070) is zinc bis(6-butoxycyclohexa-2,4-diene-1-carboxylate).
What is the SMILES notation for zinc bis(6-butoxycyclohexa-2,4-diene-1-carboxylate)?
The canonical SMILES for zinc bis(6-butoxycyclohexa-2,4-diene-1-carboxylate) is CCCCOC1C=CC=CC1C(=O)[O-].CCCCOC1C=CC=CC1C(=O)[O-].[Zn+2].
What is the InChIKey of zinc bis(6-butoxycyclohexa-2,4-diene-1-carboxylate)?
The InChIKey is ZJBYWWUKHOPTCI-UHFFFAOYSA-L. The full InChI is InChI=1S/2C11H16O3.Zn/c2*1-2-3-8-14-10-7-5-4-6-9(10)11(12)13;/h2*4-7,9-10H,2-3,8H2,1H3,(H,12,13);/q;;+2/p-2.
What are the key properties of zinc bis(6-butoxycyclohexa-2,4-diene-1-carboxylate)?
zinc bis(6-butoxycyclohexa-2,4-diene-1-carboxylate) has a molecular weight of 455.87 g/mol, XLogP of 1.33, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for zinc bis(6-butoxycyclohexa-2,4-diene-1-carboxylate) is sourced from PubChem (CID 175024070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).