C17H28ClNO3 — CID 175025393
[2-amino-6-[(2-methylpropan-2-yl)oxy]phenyl] 4,4-dimethylpentanoate;hydrochloride (PubChem CID 175025393) has the molecular formula C17H28ClNO3 and a molecular weight of 329.87 g/mol. Its IUPAC name is [2-amino-6-[(2-methylpropan-2-yl)oxy]phenyl] 4,4-dimethylpentanoate;hydrochloride.
| Compound Name | [2-amino-6-[(2-methylpropan-2-yl)oxy]phenyl] 4,4-dimethylpentanoate;hydrochloride |
|---|---|
| PubChem CID | 175025393 |
| Molecular Formula | C17H28ClNO3 |
| Molecular Weight | 329.87 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | [2-amino-6-[(2-methylpropan-2-yl)oxy]phenyl] 4,4-dimethylpentanoate;hydrochloride |
| SMILES | CC(C)(C)CCC(=O)Oc1c(N)cccc1OC(C)(C)C.Cl |
| InChI | InChI=1S/C17H27NO3.ClH/c1-16(2,3)11-10-14(19)20-15-12(18)8-7-9-13(15)21-17(4,5)6;/h7-9H,10-11,18H2,1-6H3;1H |
| InChIKey | YFGYJNVNVQUINU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.87 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|